C22H32O2S — CID 11792893
(2R,3R)-2-heptyl-3-phenylsulfanyl-1-oxaspiro[4.5]decan-4-one (PubChem CID 11792893) has the molecular formula C22H32O2S and a molecular weight of 360.56 g/mol. Its IUPAC name is (2R,3R)-2-heptyl-3-phenylsulfanyl-1-oxaspiro[4.5]decan-4-one.
| Compound Name | (2R,3R)-2-heptyl-3-phenylsulfanyl-1-oxaspiro[4.5]decan-4-one |
|---|---|
| PubChem CID | 11792893 |
| Molecular Formula | C22H32O2S |
| Molecular Weight | 360.56 g/mol |
| Exact Mass | 360.21 |
| IUPAC Name | (2R,3R)-2-heptyl-3-phenylsulfanyl-1-oxaspiro[4.5]decan-4-one |
| SMILES | CCCCCCC[C@H]1OC2(CCCCC2)C(=O)[C@@H]1Sc1ccccc1 |
| InChI | InChI=1S/C22H32O2S/c1-2-3-4-5-10-15-19-20(25-18-13-8-6-9-14-18)21(23)22(24-19)16-11-7-12-17-22/h6,8-9,13-14,19-20H,2-5,7,10-12,15-17H2,1H3/t19-,20-/m1/s1 |
| InChIKey | SMHHIWYAZCBDOQ-WOJBJXKFSA-N |
| XLogP | 6.18 |
| TPSA | 26.30 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 25 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 360.56 |
| LogP ≤ 5 | 6.18 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|