C13H16OS — CID 15576573
2-phenylsulfanyl-1-oxaspiro[2.5]octane (PubChem CID 15576573) has the molecular formula C13H16OS and a molecular weight of 220.34 g/mol. Its IUPAC name is 2-phenylsulfanyl-1-oxaspiro[2.5]octane.
| Compound Name | 2-phenylsulfanyl-1-oxaspiro[2.5]octane |
|---|---|
| PubChem CID | 15576573 |
| Molecular Formula | C13H16OS |
| Molecular Weight | 220.34 g/mol |
| Exact Mass | 220.09 |
| IUPAC Name | 2-phenylsulfanyl-1-oxaspiro[2.5]octane |
| SMILES | c1ccc(SC2OC23CCCCC3)cc1 |
| InChI | InChI=1S/C13H16OS/c1-3-7-11(8-4-1)15-12-13(14-12)9-5-2-6-10-13/h1,3-4,7-8,12H,2,5-6,9-10H2 |
| InChIKey | CTVPQFYTWKKRCQ-UHFFFAOYSA-N |
| XLogP | 3.84 |
| TPSA | 12.53 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 15 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 220.34 |
| LogP ≤ 5 | 3.84 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'Three-membered_heterocycle', 'substructure': 'N/A'} |
|---|