C17H18OS2 — CID 14100930
2,2-bis(phenylsulfanyl)oxane (PubChem CID 14100930) has the molecular formula C17H18OS2 and a molecular weight of 302.46 g/mol. Its IUPAC name is 2,2-bis(phenylsulfanyl)oxane.
| Compound Name | 2,2-bis(phenylsulfanyl)oxane |
|---|---|
| PubChem CID | 14100930 |
| Molecular Formula | C17H18OS2 |
| Molecular Weight | 302.46 g/mol |
| Exact Mass | 302.08 |
| IUPAC Name | 2,2-bis(phenylsulfanyl)oxane |
| SMILES | c1ccc(SC2(Sc3ccccc3)CCCCO2)cc1 |
| InChI | InChI=1S/C17H18OS2/c1-3-9-15(10-4-1)19-17(13-7-8-14-18-17)20-16-11-5-2-6-12-16/h1-6,9-12H,7-8,13-14H2 |
| InChIKey | YKSCLHGDEGZWSS-UHFFFAOYSA-N |
| XLogP | 5.43 |
| TPSA | 9.23 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 20 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 302.46 |
| LogP ≤ 5 | 5.43 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'het-C-het_not_in_ring', 'substructure': 'N/A'} |
|---|