C14H19NO2S — CID 134928762
methylimino-(1-oxaspiro[2.5]octan-2-yl)-oxo-phenyl-λ6-sulfane (PubChem CID 134928762) has the molecular formula C14H19NO2S and a molecular weight of 265.38 g/mol. Its IUPAC name is methylimino-(1-oxaspiro[2.5]octan-2-yl)-oxo-phenyl-λ6-sulfane.
| Compound Name | methylimino-(1-oxaspiro[2.5]octan-2-yl)-oxo-phenyl-λ6-sulfane |
|---|---|
| PubChem CID | 134928762 |
| Molecular Formula | C14H19NO2S |
| Molecular Weight | 265.38 g/mol |
| Exact Mass | 265.11 |
| IUPAC Name | methylimino-(1-oxaspiro[2.5]octan-2-yl)-oxo-phenyl-λ6-sulfane |
| SMILES | CN=S(=O)(c1ccccc1)C1OC12CCCCC2 |
| InChI | InChI=1S/C14H19NO2S/c1-15-18(16,12-8-4-2-5-9-12)13-14(17-13)10-6-3-7-11-14/h2,4-5,8-9,13H,3,6-7,10-11H2,1H3 |
| InChIKey | KQGQDAMHVCKDCU-UHFFFAOYSA-N |
| XLogP | 3.20 |
| TPSA | 41.96 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 18 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 265.38 |
| LogP ≤ 5 | 3.20 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'Three-membered_heterocycle', 'substructure': 'N/A'} |
|---|