C17H21BrO4S — CID 10621048
(3S,4S)-3-(benzenesulfonylmethyl)-4-(bromomethyl)-1-oxaspiro[4.5]decan-2-one (PubChem CID 10621048) has the molecular formula C17H21BrO4S and a molecular weight of 401.32 g/mol. Its IUPAC name is (3S,4S)-3-(benzenesulfonylmethyl)-4-(bromomethyl)-1-oxaspiro[4.5]decan-2-one.
| Compound Name | (3S,4S)-3-(benzenesulfonylmethyl)-4-(bromomethyl)-1-oxaspiro[4.5]decan-2-one |
|---|---|
| PubChem CID | 10621048 |
| Molecular Formula | C17H21BrO4S |
| Molecular Weight | 401.32 g/mol |
| Exact Mass | 400.03 |
| IUPAC Name | (3S,4S)-3-(benzenesulfonylmethyl)-4-(bromomethyl)-1-oxaspiro[4.5]decan-2-one |
| SMILES | O=C1OC2(CCCCC2)[C@@H](CBr)[C@@H]1CS(=O)(=O)c1ccccc1 |
| InChI | InChI=1S/C17H21BrO4S/c18-11-15-14(12-23(20,21)13-7-3-1-4-8-13)16(19)22-17(15)9-5-2-6-10-17/h1,3-4,7-8,14-15H,2,5-6,9-12H2/t14-,15-/m0/s1 |
| InChIKey | VBOKKBFJQZTLLR-GJZGRUSLSA-N |
| XLogP | 3.35 |
| TPSA | 60.44 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 23 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 401.32 |
| LogP ≤ 5 | 3.35 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'alkyl_halide', 'substructure': 'N/A'} |
|---|