C24H32N2O2S2 — CID 25037615
cyclopentyl-[2-[(cyclopentyl-oxo-phenyl-λ6-sulfanylidene)amino]ethylimino]-oxo-phenyl-λ6-sulfane (PubChem CID 25037615) has the molecular formula C24H32N2O2S2 and a molecular weight of 444.67 g/mol. Its IUPAC name is cyclopentyl-[2-[(cyclopentyl-oxo-phenyl-λ6-sulfanylidene)amino]ethylimino]-oxo-phenyl-λ6-sulfane.
| Compound Name | cyclopentyl-[2-[(cyclopentyl-oxo-phenyl-λ6-sulfanylidene)amino]ethylimino]-oxo-phenyl-λ6-sulfane |
|---|---|
| PubChem CID | 25037615 |
| Molecular Formula | C24H32N2O2S2 |
| Molecular Weight | 444.67 g/mol |
| Exact Mass | 444.19 |
| IUPAC Name | cyclopentyl-[2-[(cyclopentyl-oxo-phenyl-λ6-sulfanylidene)amino]ethylimino]-oxo-phenyl-λ6-sulfane |
| SMILES | O=[S@](=NCCN=[S@@](=O)(c1ccccc1)C1CCCC1)(c1ccccc1)C1CCCC1 |
| InChI | InChI=1S/C24H32N2O2S2/c27-29(23-15-7-8-16-23,21-11-3-1-4-12-21)25-19-20-26-30(28,24-17-9-10-18-24)22-13-5-2-6-14-22/h1-6,11-14,23-24H,7-10,15-20H2/t29-,30-/m1/s1 |
| InChIKey | NCYJQUQBZPCVFV-LOYHVIPDSA-N |
| XLogP | 5.93 |
| TPSA | 58.86 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 30 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 444.67 |
| LogP ≤ 5 | 5.93 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|