C13H18O4S2 — CID 141082573
cyclohexylsulfonylmethylsulfonylbenzene (PubChem CID 141082573) has the molecular formula C13H18O4S2 and a molecular weight of 302.42 g/mol. Its IUPAC name is cyclohexylsulfonylmethylsulfonylbenzene.
| Compound Name | cyclohexylsulfonylmethylsulfonylbenzene |
|---|---|
| PubChem CID | 141082573 |
| Molecular Formula | C13H18O4S2 |
| Molecular Weight | 302.42 g/mol |
| Exact Mass | 302.06 |
| IUPAC Name | cyclohexylsulfonylmethylsulfonylbenzene |
| SMILES | O=S(=O)(CS(=O)(=O)C1CCCCC1)c1ccccc1 |
| InChI | InChI=1S/C13H18O4S2/c14-18(15,12-7-3-1-4-8-12)11-19(16,17)13-9-5-2-6-10-13/h1,3-4,7-8,13H,2,5-6,9-11H2 |
| InChIKey | RDWNOIHFVCAKRB-UHFFFAOYSA-N |
| XLogP | 2.17 |
| TPSA | 68.28 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 19 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 302.42 |
| LogP ≤ 5 | 2.17 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 4 |