C22H27NO4S — CID 11795335
2-(cyclopentylmethyl)-5-[(1S,2S)-6,7-dimethoxy-2-nitro-1,2,3,4-tetrahydronaphthalen-1-yl]thiophene (PubChem CID 11795335) has the molecular formula C22H27NO4S and a molecular weight of 401.53 g/mol. Its IUPAC name is 2-(cyclopentylmethyl)-5-[(1S,2S)-6,7-dimethoxy-2-nitro-1,2,3,4-tetrahydronaphthalen-1-yl]thiophene.
| Compound Name | 2-(cyclopentylmethyl)-5-[(1S,2S)-6,7-dimethoxy-2-nitro-1,2,3,4-tetrahydronaphthalen-1-yl]thiophene |
|---|---|
| PubChem CID | 11795335 |
| Molecular Formula | C22H27NO4S |
| Molecular Weight | 401.53 g/mol |
| Exact Mass | 401.17 |
| IUPAC Name | 2-(cyclopentylmethyl)-5-[(1S,2S)-6,7-dimethoxy-2-nitro-1,2,3,4-tetrahydronaphthalen-1-yl]thiophene |
| SMILES | COc1cc2c(cc1OC)[C@H](c1ccc(CC3CCCC3)s1)[C@@H]([N+](=O)[O-])CC2 |
| InChI | InChI=1S/C22H27NO4S/c1-26-19-12-15-7-9-18(23(24)25)22(17(15)13-20(19)27-2)21-10-8-16(28-21)11-14-5-3-4-6-14/h8,10,12-14,18,22H,3-7,9,11H2,1-2H3/t18-,22-/m0/s1 |
| InChIKey | HQVIRFLAVWEVPX-AVRDEDQJSA-N |
| XLogP | 5.22 |
| TPSA | 61.60 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 28 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 401.53 |
| LogP ≤ 5 | 5.22 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'nitro_group', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|