C27H38N2O5S — CID 10767797
N-tert-butyl-3-[(1R,2S)-6,7-dimethoxy-2-nitro-1,2,3,4-tetrahydronaphthalen-1-yl]-5-(4-methylpentyl)thiophene-2-carboxamide (PubChem CID 10767797) has the molecular formula C27H38N2O5S and a molecular weight of 502.68 g/mol. Its IUPAC name is N-tert-butyl-3-[(1R,2S)-6,7-dimethoxy-2-nitro-1,2,3,4-tetrahydronaphthalen-1-yl]-5-(4-methylpentyl)thiophene-2-carboxamide.
| Compound Name | N-tert-butyl-3-[(1R,2S)-6,7-dimethoxy-2-nitro-1,2,3,4-tetrahydronaphthalen-1-yl]-5-(4-methylpentyl)thiophene-2-carboxamide |
|---|---|
| PubChem CID | 10767797 |
| Molecular Formula | C27H38N2O5S |
| Molecular Weight | 502.68 g/mol |
| Exact Mass | 502.25 |
| IUPAC Name | N-tert-butyl-3-[(1R,2S)-6,7-dimethoxy-2-nitro-1,2,3,4-tetrahydronaphthalen-1-yl]-5-(4-methylpentyl)thiophene-2-carboxamide |
| SMILES | COc1cc2c(cc1OC)[C@H](c1cc(CCCC(C)C)sc1C(=O)NC(C)(C)C)[C@@H]([N+](=O)[O-])CC2 |
| InChI | InChI=1S/C27H38N2O5S/c1-16(2)9-8-10-18-14-20(25(35-18)26(30)28-27(3,4)5)24-19-15-23(34-7)22(33-6)13-17(19)11-12-21(24)29(31)32/h13-16,21,24H,8-12H2,1-7H3,(H,28,30)/t21-,24+/m0/s1 |
| InChIKey | AXYUEKDIXRKSNZ-XUZZJYLKSA-N |
| XLogP | 6.00 |
| TPSA | 90.70 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 9 |
| Heavy Atoms | 35 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 502.68 |
| LogP ≤ 5 | 6.00 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'nitro_group', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|