C19H22N2O5 — CID 67714445
[3-[(1R,2S)-6,7-dimethoxy-2-nitro-1,2,3,4-tetrahydronaphthalen-1-yl]-5-methyl-4-pyridinyl]methanol (PubChem CID 67714445) has the molecular formula C19H22N2O5 and a molecular weight of 358.39 g/mol. Its IUPAC name is [3-[(1R,2S)-6,7-dimethoxy-2-nitro-1,2,3,4-tetrahydronaphthalen-1-yl]-5-methyl-4-pyridinyl]methanol.
| Compound Name | [3-[(1R,2S)-6,7-dimethoxy-2-nitro-1,2,3,4-tetrahydronaphthalen-1-yl]-5-methyl-4-pyridinyl]methanol |
|---|---|
| PubChem CID | 67714445 |
| Molecular Formula | C19H22N2O5 |
| Molecular Weight | 358.39 g/mol |
| Exact Mass | 358.15 |
| IUPAC Name | [3-[(1R,2S)-6,7-dimethoxy-2-nitro-1,2,3,4-tetrahydronaphthalen-1-yl]-5-methyl-4-pyridinyl]methanol |
| SMILES | COc1cc2c(cc1OC)[C@H](c1cncc(C)c1CO)[C@@H]([N+](=O)[O-])CC2 |
| InChI | InChI=1S/C19H22N2O5/c1-11-8-20-9-14(15(11)10-22)19-13-7-18(26-3)17(25-2)6-12(13)4-5-16(19)21(23)24/h6-9,16,19,22H,4-5,10H2,1-3H3/t16-,19+/m0/s1 |
| InChIKey | PLLLGYPAELFWBT-QFBILLFUSA-N |
| XLogP | 2.62 |
| TPSA | 94.72 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 26 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 358.39 |
| LogP ≤ 5 | 2.62 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'nitro_group', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|