C25H39NO5 — CID 155598214
[6-(2-amino-6,7-dimethoxy-1,2,3,4-tetrahydronaphthalen-1-yl)-2,3-dimethoxyphenyl]methanol;ethane (PubChem CID 155598214) has the molecular formula C25H39NO5 and a molecular weight of 433.59 g/mol. Its IUPAC name is [6-(2-amino-6,7-dimethoxy-1,2,3,4-tetrahydronaphthalen-1-yl)-2,3-dimethoxyphenyl]methanol;ethane.
| Compound Name | [6-(2-amino-6,7-dimethoxy-1,2,3,4-tetrahydronaphthalen-1-yl)-2,3-dimethoxyphenyl]methanol;ethane |
|---|---|
| PubChem CID | 155598214 |
| Molecular Formula | C25H39NO5 |
| Molecular Weight | 433.59 g/mol |
| Exact Mass | 433.28 |
| IUPAC Name | [6-(2-amino-6,7-dimethoxy-1,2,3,4-tetrahydronaphthalen-1-yl)-2,3-dimethoxyphenyl]methanol;ethane |
| SMILES | CC.CC.COc1cc2c(cc1OC)C(c1ccc(OC)c(OC)c1CO)C(N)CC2 |
| InChI | InChI=1S/C21H27NO5.2C2H6/c1-24-17-8-6-13(15(11-23)21(17)27-4)20-14-10-19(26-3)18(25-2)9-12(14)5-7-16(20)22;2*1-2/h6,8-10,16,20,23H,5,7,11,22H2,1-4H3;2*1-2H3 |
| InChIKey | OJTGDELIXZUYMN-UHFFFAOYSA-N |
| XLogP | 4.67 |
| TPSA | 83.17 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 31 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 433.59 |
| LogP ≤ 5 | 4.67 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 6 |