C21H27NO2S — CID 10760804
N-[(1S,2S)-1-(5-butylthiophen-2-yl)-6,7-dimethoxy-1,2,3,4-tetrahydronaphthalen-2-yl]methanimine (PubChem CID 10760804) has the molecular formula C21H27NO2S and a molecular weight of 357.52 g/mol. Its IUPAC name is N-[(1S,2S)-1-(5-butylthiophen-2-yl)-6,7-dimethoxy-1,2,3,4-tetrahydronaphthalen-2-yl]methanimine.
| Compound Name | N-[(1S,2S)-1-(5-butylthiophen-2-yl)-6,7-dimethoxy-1,2,3,4-tetrahydronaphthalen-2-yl]methanimine |
|---|---|
| PubChem CID | 10760804 |
| Molecular Formula | C21H27NO2S |
| Molecular Weight | 357.52 g/mol |
| Exact Mass | 357.18 |
| IUPAC Name | N-[(1S,2S)-1-(5-butylthiophen-2-yl)-6,7-dimethoxy-1,2,3,4-tetrahydronaphthalen-2-yl]methanimine |
| SMILES | C=N[C@H]1CCc2cc(OC)c(OC)cc2[C@@H]1c1ccc(CCCC)s1 |
| InChI | InChI=1S/C21H27NO2S/c1-5-6-7-15-9-11-20(25-15)21-16-13-19(24-4)18(23-3)12-14(16)8-10-17(21)22-2/h9,11-13,17,21H,2,5-8,10H2,1,3-4H3/t17-,21-/m0/s1 |
| InChIKey | SBMIEVCNGGLRLA-UWJYYQICSA-N |
| XLogP | 5.26 |
| TPSA | 30.82 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 25 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 357.52 |
| LogP ≤ 5 | 5.26 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'imine_1', 'substructure': 'N/A'} |
|---|