C24H32O7 — CID 11796978
[(3bS,6S,7S,9aR)-7-acetyloxy-3b-(hydroxymethyl)-6,9a-dimethyl-8-oxo-4,5,5a,7,9,9b,10,11-octahydronaphtho[2,1-e][2]benzofuran-6-yl]methyl acetate (PubChem CID 11796978) has the molecular formula C24H32O7 and a molecular weight of 432.51 g/mol. Its IUPAC name is [(3bS,6S,7S,9aR)-7-acetyloxy-3b-(hydroxymethyl)-6,9a-dimethyl-8-oxo-4,5,5a,7,9,9b,10,11-octahydronaphtho[2,1-e][2]benzofuran-6-yl]methyl acetate.
| Compound Name | [(3bS,6S,7S,9aR)-7-acetyloxy-3b-(hydroxymethyl)-6,9a-dimethyl-8-oxo-4,5,5a,7,9,9b,10,11-octahydronaphtho[2,1-e][2]benzofuran-6-yl]methyl acetate |
|---|---|
| PubChem CID | 11796978 |
| Molecular Formula | C24H32O7 |
| Molecular Weight | 432.51 g/mol |
| Exact Mass | 432.21 |
| IUPAC Name | [(3bS,6S,7S,9aR)-7-acetyloxy-3b-(hydroxymethyl)-6,9a-dimethyl-8-oxo-4,5,5a,7,9,9b,10,11-octahydronaphtho[2,1-e][2]benzofuran-6-yl]methyl acetate |
| SMILES | CC(=O)OC[C@]1(C)C2CC[C@@]3(CO)c4cocc4CCC3[C@@]2(C)CC(=O)[C@H]1OC(C)=O |
| InChI | InChI=1S/C24H32O7/c1-14(26)30-13-23(4)19-7-8-24(12-25)17-11-29-10-16(17)5-6-20(24)22(19,3)9-18(28)21(23)31-15(2)27/h10-11,19-21,25H,5-9,12-13H2,1-4H3/t19?,20?,21-,22+,23-,24-/m1/s1 |
| InChIKey | KEJUHYOUZRBMDF-GHNNLAFXSA-N |
| XLogP | 2.96 |
| TPSA | 103.04 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 31 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 432.51 |
| LogP ≤ 5 | 2.96 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 7 |