C24H30O9 — CID 163195934
(6,9-diacetyloxy-7,8-dihydroxy-5a,9b-dimethyl-3b,4,5,6,9,9a,10,11-octahydronaphtho[2,1-e][2]benzofuran-4-yl) acetate (PubChem CID 163195934) has the molecular formula C24H30O9 and a molecular weight of 462.50 g/mol. Its IUPAC name is (6,9-diacetyloxy-7,8-dihydroxy-5a,9b-dimethyl-3b,4,5,6,9,9a,10,11-octahydronaphtho[2,1-e][2]benzofuran-4-yl) acetate.
| Compound Name | (6,9-diacetyloxy-7,8-dihydroxy-5a,9b-dimethyl-3b,4,5,6,9,9a,10,11-octahydronaphtho[2,1-e][2]benzofuran-4-yl) acetate |
|---|---|
| PubChem CID | 163195934 |
| Molecular Formula | C24H30O9 |
| Molecular Weight | 462.50 g/mol |
| Exact Mass | 462.19 |
| IUPAC Name | (6,9-diacetyloxy-7,8-dihydroxy-5a,9b-dimethyl-3b,4,5,6,9,9a,10,11-octahydronaphtho[2,1-e][2]benzofuran-4-yl) acetate |
| SMILES | CC(=O)OC1CC2(C)C(OC(C)=O)C(O)=C(O)C(OC(C)=O)C2C2(C)CCc3cocc3C12 |
| InChI | InChI=1S/C24H30O9/c1-11(25)31-16-8-24(5)21(23(4)7-6-14-9-30-10-15(14)17(16)23)20(32-12(2)26)18(28)19(29)22(24)33-13(3)27/h9-10,16-17,20-22,28-29H,6-8H2,1-5H3 |
| InChIKey | KWUQOQYCKOCLHJ-UHFFFAOYSA-N |
| XLogP | 3.48 |
| TPSA | 132.50 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 9 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 33 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 462.50 |
| LogP ≤ 5 | 3.48 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 9 |
| Structural Alerts | {'alert_name': '>_2_ester_groups', 'substructure': 'N/A'} |
|---|