C22H30O4 — CID 163113531
(3b,6,6,9a-tetramethyl-8-oxo-4,5,5a,7,9,9b,10,11-octahydronaphtho[2,1-e][2]benzofuran-7-yl) acetate (PubChem CID 163113531) has the molecular formula C22H30O4 and a molecular weight of 358.48 g/mol. Its IUPAC name is (3b,6,6,9a-tetramethyl-8-oxo-4,5,5a,7,9,9b,10,11-octahydronaphtho[2,1-e][2]benzofuran-7-yl) acetate.
| Compound Name | (3b,6,6,9a-tetramethyl-8-oxo-4,5,5a,7,9,9b,10,11-octahydronaphtho[2,1-e][2]benzofuran-7-yl) acetate |
|---|---|
| PubChem CID | 163113531 |
| Molecular Formula | C22H30O4 |
| Molecular Weight | 358.48 g/mol |
| Exact Mass | 358.21 |
| IUPAC Name | (3b,6,6,9a-tetramethyl-8-oxo-4,5,5a,7,9,9b,10,11-octahydronaphtho[2,1-e][2]benzofuran-7-yl) acetate |
| SMILES | CC(=O)OC1C(=O)CC2(C)C3CCc4cocc4C3(C)CCC2C1(C)C |
| InChI | InChI=1S/C22H30O4/c1-13(23)26-19-16(24)10-22(5)17(20(19,2)3)8-9-21(4)15-12-25-11-14(15)6-7-18(21)22/h11-12,17-19H,6-10H2,1-5H3 |
| InChIKey | SMKCOMIUBIKXNU-UHFFFAOYSA-N |
| XLogP | 4.45 |
| TPSA | 56.51 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 1 |
| Heavy Atoms | 26 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 358.48 |
| LogP ≤ 5 | 4.45 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 4 |