C22H31BrO4 — CID 5248276
(11-bromo-5,5,9,13-tetramethyl-7,12-dioxo-6-tetracyclo[11.2.1.01,10.04,9]hexadecanyl) acetate (PubChem CID 5248276) has the molecular formula C22H31BrO4 and a molecular weight of 439.39 g/mol. Its IUPAC name is (11-bromo-5,5,9,13-tetramethyl-7,12-dioxo-6-tetracyclo[11.2.1.01,10.04,9]hexadecanyl) acetate.
| Compound Name | (11-bromo-5,5,9,13-tetramethyl-7,12-dioxo-6-tetracyclo[11.2.1.01,10.04,9]hexadecanyl) acetate |
|---|---|
| PubChem CID | 5248276 |
| Molecular Formula | C22H31BrO4 |
| Molecular Weight | 439.39 g/mol |
| Exact Mass | 438.14 |
| IUPAC Name | (11-bromo-5,5,9,13-tetramethyl-7,12-dioxo-6-tetracyclo[11.2.1.01,10.04,9]hexadecanyl) acetate |
| SMILES | CC(=O)OC1C(=O)CC2(C)C3C(Br)C(=O)C4(C)CCC3(CCC2C1(C)C)C4 |
| InChI | InChI=1S/C22H31BrO4/c1-12(24)27-18-13(25)10-21(5)14(19(18,2)3)6-7-22-9-8-20(4,11-22)17(26)15(23)16(21)22/h14-16,18H,6-11H2,1-5H3 |
| InChIKey | UMVHCXFKSVRCAP-UHFFFAOYSA-N |
| XLogP | 4.47 |
| TPSA | 60.44 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 1 |
| Heavy Atoms | 27 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 439.39 |
| LogP ≤ 5 | 4.47 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'alkyl_halide', 'substructure': 'N/A'} |
|---|