C21H32O2 — CID 71762133
[(3bR,5aR,6S,9aR,9bR)-3b,5a,6,9a-tetramethyl-4,5,7,8,9,9b,10,11-octahydronaphtho[2,1-e][2]benzofuran-6-yl]methanol (PubChem CID 71762133) has the molecular formula C21H32O2 and a molecular weight of 316.49 g/mol. Its IUPAC name is [(3bR,5aR,6S,9aR,9bR)-3b,5a,6,9a-tetramethyl-4,5,7,8,9,9b,10,11-octahydronaphtho[2,1-e][2]benzofuran-6-yl]methanol.
| Compound Name | [(3bR,5aR,6S,9aR,9bR)-3b,5a,6,9a-tetramethyl-4,5,7,8,9,9b,10,11-octahydronaphtho[2,1-e][2]benzofuran-6-yl]methanol |
|---|---|
| PubChem CID | 71762133 |
| Molecular Formula | C21H32O2 |
| Molecular Weight | 316.49 g/mol |
| Exact Mass | 316.24 |
| IUPAC Name | [(3bR,5aR,6S,9aR,9bR)-3b,5a,6,9a-tetramethyl-4,5,7,8,9,9b,10,11-octahydronaphtho[2,1-e][2]benzofuran-6-yl]methanol |
| SMILES | C[C@]1(CO)CCC[C@]2(C)[C@H]3CCc4cocc4[C@]3(C)CC[C@@]12C |
| InChI | InChI=1S/C21H32O2/c1-18(14-22)8-5-9-20(3)17-7-6-15-12-23-13-16(15)19(17,2)10-11-21(18,20)4/h12-13,17,22H,5-11,14H2,1-4H3/t17-,18+,19-,20+,21-/m0/s1 |
| InChIKey | COUCLILLTMEDMW-LUYSREMJSA-N |
| XLogP | 5.09 |
| TPSA | 33.37 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 1 |
| Heavy Atoms | 23 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 316.49 |
| LogP ≤ 5 | 5.09 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 2 |