C22H42O7Si2 — CID 11798747
methyl (3R,4R,5S,6R)-3-acetyloxy-5,6-bis[[tert-butyl(dimethyl)silyl]oxy]-4-hydroxycyclohexene-1-carboxylate (PubChem CID 11798747) has the molecular formula C22H42O7Si2 and a molecular weight of 474.74 g/mol. Its IUPAC name is methyl (3R,4R,5S,6R)-3-acetyloxy-5,6-bis[[tert-butyl(dimethyl)silyl]oxy]-4-hydroxycyclohexene-1-carboxylate.
| Compound Name | methyl (3R,4R,5S,6R)-3-acetyloxy-5,6-bis[[tert-butyl(dimethyl)silyl]oxy]-4-hydroxycyclohexene-1-carboxylate |
|---|---|
| PubChem CID | 11798747 |
| Molecular Formula | C22H42O7Si2 |
| Molecular Weight | 474.74 g/mol |
| Exact Mass | 474.25 |
| IUPAC Name | methyl (3R,4R,5S,6R)-3-acetyloxy-5,6-bis[[tert-butyl(dimethyl)silyl]oxy]-4-hydroxycyclohexene-1-carboxylate |
| SMILES | COC(=O)C1=C[C@@H](OC(C)=O)[C@@H](O)[C@H](O[Si](C)(C)C(C)(C)C)[C@@H]1O[Si](C)(C)C(C)(C)C |
| InChI | InChI=1S/C22H42O7Si2/c1-14(23)27-16-13-15(20(25)26-8)18(28-30(9,10)21(2,3)4)19(17(16)24)29-31(11,12)22(5,6)7/h13,16-19,24H,1-12H3/t16-,17-,18-,19+/m1/s1 |
| InChIKey | OBPMUXDTOFFDPL-MKXGPGLRSA-N |
| XLogP | 4.17 |
| TPSA | 91.29 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 31 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 474.74 |
| LogP ≤ 5 | 4.17 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': 'heavy_metal', 'substructure': 'N/A'} |
|---|