C31H40O6 — CID 11799805
[(1R,4R,5S)-5-[(1S,2R,3R,5R)-3-acetyloxy-2-(acetyloxymethyl)-5-[(2Z)-6-methylhepta-2,5-dien-2-yl]cyclopentyl]-4-methylcyclopent-2-en-1-yl] benzoate (PubChem CID 11799805) has the molecular formula C31H40O6 and a molecular weight of 508.66 g/mol. Its IUPAC name is [(1R,4R,5S)-5-[(1S,2R,3R,5R)-3-acetyloxy-2-(acetyloxymethyl)-5-[(2Z)-6-methylhepta-2,5-dien-2-yl]cyclopentyl]-4-methylcyclopent-2-en-1-yl] benzoate.
| Compound Name | [(1R,4R,5S)-5-[(1S,2R,3R,5R)-3-acetyloxy-2-(acetyloxymethyl)-5-[(2Z)-6-methylhepta-2,5-dien-2-yl]cyclopentyl]-4-methylcyclopent-2-en-1-yl] benzoate |
|---|---|
| PubChem CID | 11799805 |
| Molecular Formula | C31H40O6 |
| Molecular Weight | 508.66 g/mol |
| Exact Mass | 508.28 |
| IUPAC Name | [(1R,4R,5S)-5-[(1S,2R,3R,5R)-3-acetyloxy-2-(acetyloxymethyl)-5-[(2Z)-6-methylhepta-2,5-dien-2-yl]cyclopentyl]-4-methylcyclopent-2-en-1-yl] benzoate |
| SMILES | CC(=O)OC[C@H]1[C@H]([C@@H]2[C@H](C)C=C[C@H]2OC(=O)c2ccccc2)[C@H](/C(C)=C\CC=C(C)C)C[C@H]1OC(C)=O |
| InChI | InChI=1S/C31H40O6/c1-19(2)11-10-12-20(3)25-17-28(36-23(6)33)26(18-35-22(5)32)30(25)29-21(4)15-16-27(29)37-31(34)24-13-8-7-9-14-24/h7-9,11-16,21,25-30H,10,17-18H2,1-6H3/b20-12-/t21-,25+,26-,27-,28-,29-,30-/m1/s1 |
| InChIKey | YVNMKJKBVFXVOH-DQPCITSTSA-N |
| XLogP | 6.08 |
| TPSA | 78.90 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 9 |
| Heavy Atoms | 37 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 508.66 |
| LogP ≤ 5 | 6.08 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': '>_2_ester_groups', 'substructure': 'N/A'}, {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|