C21H24NO3+ — CID 118000318
(13aS)-8-ethyl-3-(hydroxymethyl)-10-methoxy-5,6,13,13a-tetrahydroisoquinolino[2,1-b]isoquinolin-7-ium-11-ol (PubChem CID 118000318) has the molecular formula C21H24NO3+ and a molecular weight of 338.43 g/mol. Its IUPAC name is (13aS)-8-ethyl-3-(hydroxymethyl)-10-methoxy-5,6,13,13a-tetrahydroisoquinolino[2,1-b]isoquinolin-7-ium-11-ol.
| Compound Name | (13aS)-8-ethyl-3-(hydroxymethyl)-10-methoxy-5,6,13,13a-tetrahydroisoquinolino[2,1-b]isoquinolin-7-ium-11-ol |
|---|---|
| PubChem CID | 118000318 |
| Molecular Formula | C21H24NO3+ |
| Molecular Weight | 338.43 g/mol |
| Exact Mass | 338.18 |
| IUPAC Name | (13aS)-8-ethyl-3-(hydroxymethyl)-10-methoxy-5,6,13,13a-tetrahydroisoquinolino[2,1-b]isoquinolin-7-ium-11-ol |
| SMILES | CCC1=[N+]2CCc3cc(CO)ccc3[C@@H]2Cc2cc(O)c(OC)cc21 |
| InChI | InChI=1S/C21H23NO3/c1-3-18-17-11-21(25-2)20(24)10-15(17)9-19-16-5-4-13(12-23)8-14(16)6-7-22(18)19/h4-5,8,10-11,19,23H,3,6-7,9,12H2,1-2H3/p+1/t19-/m0/s1 |
| InChIKey | CVOGNSNTGMEMHN-IBGZPJMESA-O |
| XLogP | 2.96 |
| TPSA | 52.70 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 25 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 338.43 |
| LogP ≤ 5 | 2.96 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'quaternary_nitrogen_1', 'substructure': 'N/A'} |
|---|