C19H17N5 — CID 118000646
N,N-dimethyl-6-phenyl-2-pyrazol-1-ylquinazolin-4-amine (PubChem CID 118000646) has the molecular formula C19H17N5 and a molecular weight of 315.38 g/mol. Its IUPAC name is N,N-dimethyl-6-phenyl-2-pyrazol-1-ylquinazolin-4-amine.
| Compound Name | N,N-dimethyl-6-phenyl-2-pyrazol-1-ylquinazolin-4-amine |
|---|---|
| PubChem CID | 118000646 |
| Molecular Formula | C19H17N5 |
| Molecular Weight | 315.38 g/mol |
| Exact Mass | 315.15 |
| IUPAC Name | N,N-dimethyl-6-phenyl-2-pyrazol-1-ylquinazolin-4-amine |
| SMILES | CN(C)c1nc(-n2cccn2)nc2ccc(-c3ccccc3)cc12 |
| InChI | InChI=1S/C19H17N5/c1-23(2)18-16-13-15(14-7-4-3-5-8-14)9-10-17(16)21-19(22-18)24-12-6-11-20-24/h3-13H,1-2H3 |
| InChIKey | PZAWKHRAGNWVLP-UHFFFAOYSA-N |
| XLogP | 3.55 |
| TPSA | 46.84 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 24 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 315.38 |
| LogP ≤ 5 | 3.55 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 5 |