C28H30O4 — CID 118004576
7-[3-ethyl-5-(3-phenylmethoxyphenyl)phenyl]-4-oxoheptanoic acid (PubChem CID 118004576) has the molecular formula C28H30O4 and a molecular weight of 430.54 g/mol. Its IUPAC name is 7-[3-ethyl-5-(3-phenylmethoxyphenyl)phenyl]-4-oxoheptanoic acid.
| Compound Name | 7-[3-ethyl-5-(3-phenylmethoxyphenyl)phenyl]-4-oxoheptanoic acid |
|---|---|
| PubChem CID | 118004576 |
| Molecular Formula | C28H30O4 |
| Molecular Weight | 430.54 g/mol |
| Exact Mass | 430.21 |
| IUPAC Name | 7-[3-ethyl-5-(3-phenylmethoxyphenyl)phenyl]-4-oxoheptanoic acid |
| SMILES | CCc1cc(CCCC(=O)CCC(=O)O)cc(-c2cccc(OCc3ccccc3)c2)c1 |
| InChI | InChI=1S/C28H30O4/c1-2-21-16-23(10-6-12-26(29)14-15-28(30)31)18-25(17-21)24-11-7-13-27(19-24)32-20-22-8-4-3-5-9-22/h3-5,7-9,11,13,16-19H,2,6,10,12,14-15,20H2,1H3,(H,30,31) |
| InChIKey | ZGDZWTLCRAXQHU-UHFFFAOYSA-N |
| XLogP | 6.25 |
| TPSA | 63.60 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 12 |
| Heavy Atoms | 32 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 430.54 |
| LogP ≤ 5 | 6.25 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |