C19H20O4 — CID 118004977
4-[(3-ethyl-5-phenylphenyl)methoxy]-4-oxobutanoic acid (PubChem CID 118004977) has the molecular formula C19H20O4 and a molecular weight of 312.37 g/mol. Its IUPAC name is 4-[(3-ethyl-5-phenylphenyl)methoxy]-4-oxobutanoic acid.
| Compound Name | 4-[(3-ethyl-5-phenylphenyl)methoxy]-4-oxobutanoic acid |
|---|---|
| PubChem CID | 118004977 |
| Molecular Formula | C19H20O4 |
| Molecular Weight | 312.37 g/mol |
| Exact Mass | 312.14 |
| IUPAC Name | 4-[(3-ethyl-5-phenylphenyl)methoxy]-4-oxobutanoic acid |
| SMILES | CCc1cc(COC(=O)CCC(=O)O)cc(-c2ccccc2)c1 |
| InChI | InChI=1S/C19H20O4/c1-2-14-10-15(13-23-19(22)9-8-18(20)21)12-17(11-14)16-6-4-3-5-7-16/h3-7,10-12H,2,8-9,13H2,1H3,(H,20,21) |
| InChIKey | YFUOJAUXJQRFMD-UHFFFAOYSA-N |
| XLogP | 3.82 |
| TPSA | 63.60 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 23 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 312.37 |
| LogP ≤ 5 | 3.82 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |