About 4-O-[[3-(hydroxymethyl)-5-phenylphenyl]methyl] 1-O-methyl butanedioate
4-O-[[3-(hydroxymethyl)-5-phenylphenyl]methyl] 1-O-methyl butanedioate (PubChem CID 144823143) has the molecular formula C19H20O5
and a molecular weight of 328.36 g/mol. Its IUPAC name is 4-O-[[3-(hydroxymethyl)-5-phenylphenyl]methyl] 1-O-methyl butanedioate.
Molecular Properties
| Compound Name | 4-O-[[3-(hydroxymethyl)-5-phenylphenyl]methyl] 1-O-methyl butanedioate |
| PubChem CID | 144823143 |
| Molecular Formula | C19H20O5 |
| Molecular Weight | 328.36 g/mol |
| Exact Mass | 328.13 |
| IUPAC Name | 4-O-[[3-(hydroxymethyl)-5-phenylphenyl]methyl] 1-O-methyl butanedioate |
| SMILES | COC(=O)CCC(=O)OCc1cc(CO)cc(-c2ccccc2)c1 |
| InChI | InChI=1S/C19H20O5/c1-23-18(21)7-8-19(22)24-13-15-9-14(12-20)10-17(11-15)16-5-3-2-4-6-16/h2-6,9-11,20H,7-8,12-13H2,1H3 |
| InChIKey | CCRWWFLPQMGCKJ-UHFFFAOYSA-N |
| XLogP | 2.84 |
| TPSA | 72.83 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 24 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 328.36 |
| LogP ≤ 5 | 2.84 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 5 |
Analyze 4-O-[[3-(hydroxymethyl)-5-phenylphenyl]methyl] 1-O-methyl butanedioate with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 4-O-[[3-(hydroxymethyl)-5-phenylphenyl]methyl] 1-O-methyl butanedioate?
The IUPAC name of 4-O-[[3-(hydroxymethyl)-5-phenylphenyl]methyl] 1-O-methyl butanedioate (CID 144823143) is 4-O-[[3-(hydroxymethyl)-5-phenylphenyl]methyl] 1-O-methyl butanedioate.
What is the SMILES notation for 4-O-[[3-(hydroxymethyl)-5-phenylphenyl]methyl] 1-O-methyl butanedioate?
The canonical SMILES for 4-O-[[3-(hydroxymethyl)-5-phenylphenyl]methyl] 1-O-methyl butanedioate is COC(=O)CCC(=O)OCc1cc(CO)cc(-c2ccccc2)c1.
What is the InChIKey of 4-O-[[3-(hydroxymethyl)-5-phenylphenyl]methyl] 1-O-methyl butanedioate?
The InChIKey is CCRWWFLPQMGCKJ-UHFFFAOYSA-N. The full InChI is InChI=1S/C19H20O5/c1-23-18(21)7-8-19(22)24-13-15-9-14(12-20)10-17(11-15)16-5-3-2-4-6-16/h2-6,9-11,20H,7-8,12-13H2,1H3.
What are the key properties of 4-O-[[3-(hydroxymethyl)-5-phenylphenyl]methyl] 1-O-methyl butanedioate?
4-O-[[3-(hydroxymethyl)-5-phenylphenyl]methyl] 1-O-methyl butanedioate has a molecular weight of 328.36 g/mol, XLogP of 2.84, 7 rotatable bonds, 1 hydrogen bond donors, and 5 hydrogen bond acceptors.
Where does this data come from?
All data for 4-O-[[3-(hydroxymethyl)-5-phenylphenyl]methyl] 1-O-methyl butanedioate is sourced from PubChem (CID 144823143), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).