C31H31NO7 — CID 118015243
(4aS,11aR,12aS)-3-acetyl-8-(4-acetylphenyl)-10-(dimethylamino)-4,6,7-trihydroxy-4a-methyl-11,11a,12,12a-tetrahydro-1H-tetracene-2,5-dione (PubChem CID 118015243) has the molecular formula C31H31NO7 and a molecular weight of 529.59 g/mol. Its IUPAC name is (4aS,11aR,12aS)-3-acetyl-8-(4-acetylphenyl)-10-(dimethylamino)-4,6,7-trihydroxy-4a-methyl-11,11a,12,12a-tetrahydro-1H-tetracene-2,5-dione.
| Compound Name | (4aS,11aR,12aS)-3-acetyl-8-(4-acetylphenyl)-10-(dimethylamino)-4,6,7-trihydroxy-4a-methyl-11,11a,12,12a-tetrahydro-1H-tetracene-2,5-dione |
|---|---|
| PubChem CID | 118015243 |
| Molecular Formula | C31H31NO7 |
| Molecular Weight | 529.59 g/mol |
| Exact Mass | 529.21 |
| IUPAC Name | (4aS,11aR,12aS)-3-acetyl-8-(4-acetylphenyl)-10-(dimethylamino)-4,6,7-trihydroxy-4a-methyl-11,11a,12,12a-tetrahydro-1H-tetracene-2,5-dione |
| SMILES | CC(=O)C1=C(O)[C@@]2(C)C(=O)C3=C(O)c4c(O)c(-c5ccc(C(C)=O)cc5)cc(N(C)C)c4C[C@H]3C[C@H]2CC1=O |
| InChI | InChI=1S/C31H31NO7/c1-14(33)16-6-8-17(9-7-16)20-13-22(32(4)5)21-11-18-10-19-12-23(35)24(15(2)34)29(38)31(19,3)30(39)25(18)28(37)26(21)27(20)36/h6-9,13,18-19,36-38H,10-12H2,1-5H3/t18-,19+,31+/m1/s1 |
| InChIKey | LJEPFVIHXXMRQH-YEVIJXJFSA-N |
| XLogP | 4.74 |
| TPSA | 132.21 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 8 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 39 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 529.59 |
| LogP ≤ 5 | 4.74 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 8 |
| Structural Alerts | {'alert_name': 'Michael_acceptor_4', 'substructure': 'N/A'} |
|---|