About N-[5-[3-methyl-1-(1,3-thiazol-2-yl)pyrazol-4-yl]thiophen-2-yl]acetamide
N-[5-[3-methyl-1-(1,3-thiazol-2-yl)pyrazol-4-yl]thiophen-2-yl]acetamide (PubChem CID 118016504) has the molecular formula C13H12N4OS2
and a molecular weight of 304.40 g/mol. Its IUPAC name is N-[5-[3-methyl-1-(1,3-thiazol-2-yl)pyrazol-4-yl]thiophen-2-yl]acetamide.
Molecular Properties
| Compound Name | N-[5-[3-methyl-1-(1,3-thiazol-2-yl)pyrazol-4-yl]thiophen-2-yl]acetamide |
| PubChem CID | 118016504 |
| Molecular Formula | C13H12N4OS2 |
| Molecular Weight | 304.40 g/mol |
| Exact Mass | 304.05 |
| IUPAC Name | N-[5-[3-methyl-1-(1,3-thiazol-2-yl)pyrazol-4-yl]thiophen-2-yl]acetamide |
| SMILES | CC(=O)Nc1ccc(-c2cn(-c3nccs3)nc2C)s1 |
| InChI | InChI=1S/C13H12N4OS2/c1-8-10(7-17(16-8)13-14-5-6-19-13)11-3-4-12(20-11)15-9(2)18/h3-7H,1-2H3,(H,15,18) |
| InChIKey | UFGJSUMYGLJUBW-UHFFFAOYSA-N |
| XLogP | 3.32 |
| TPSA | 59.81 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 20 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 304.40 |
| LogP ≤ 5 | 3.32 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 6 |
Analyze N-[5-[3-methyl-1-(1,3-thiazol-2-yl)pyrazol-4-yl]thiophen-2-yl]acetamide with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of N-[5-[3-methyl-1-(1,3-thiazol-2-yl)pyrazol-4-yl]thiophen-2-yl]acetamide?
The IUPAC name of N-[5-[3-methyl-1-(1,3-thiazol-2-yl)pyrazol-4-yl]thiophen-2-yl]acetamide (CID 118016504) is N-[5-[3-methyl-1-(1,3-thiazol-2-yl)pyrazol-4-yl]thiophen-2-yl]acetamide.
What is the SMILES notation for N-[5-[3-methyl-1-(1,3-thiazol-2-yl)pyrazol-4-yl]thiophen-2-yl]acetamide?
The canonical SMILES for N-[5-[3-methyl-1-(1,3-thiazol-2-yl)pyrazol-4-yl]thiophen-2-yl]acetamide is CC(=O)Nc1ccc(-c2cn(-c3nccs3)nc2C)s1.
What is the InChIKey of N-[5-[3-methyl-1-(1,3-thiazol-2-yl)pyrazol-4-yl]thiophen-2-yl]acetamide?
The InChIKey is UFGJSUMYGLJUBW-UHFFFAOYSA-N. The full InChI is InChI=1S/C13H12N4OS2/c1-8-10(7-17(16-8)13-14-5-6-19-13)11-3-4-12(20-11)15-9(2)18/h3-7H,1-2H3,(H,15,18).
What are the key properties of N-[5-[3-methyl-1-(1,3-thiazol-2-yl)pyrazol-4-yl]thiophen-2-yl]acetamide?
N-[5-[3-methyl-1-(1,3-thiazol-2-yl)pyrazol-4-yl]thiophen-2-yl]acetamide has a molecular weight of 304.40 g/mol, XLogP of 3.32, 3 rotatable bonds, 1 hydrogen bond donors, and 6 hydrogen bond acceptors.
Where does this data come from?
All data for N-[5-[3-methyl-1-(1,3-thiazol-2-yl)pyrazol-4-yl]thiophen-2-yl]acetamide is sourced from PubChem (CID 118016504), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).