C6H6N4S — CID 130652343
2-(3-methyl-1,2,4-triazol-1-yl)-1,3-thiazole (PubChem CID 130652343) has the molecular formula C6H6N4S and a molecular weight of 166.21 g/mol. Its IUPAC name is 2-(3-methyl-1,2,4-triazol-1-yl)-1,3-thiazole.
| Compound Name | 2-(3-methyl-1,2,4-triazol-1-yl)-1,3-thiazole |
|---|---|
| PubChem CID | 130652343 |
| Molecular Formula | C6H6N4S |
| Molecular Weight | 166.21 g/mol |
| Exact Mass | 166.03 |
| IUPAC Name | 2-(3-methyl-1,2,4-triazol-1-yl)-1,3-thiazole |
| SMILES | Cc1ncn(-c2nccs2)n1 |
| InChI | InChI=1S/C6H6N4S/c1-5-8-4-10(9-5)6-7-2-3-11-6/h2-4H,1H3 |
| InChIKey | GHCIHSQFOWIVSA-UHFFFAOYSA-N |
| XLogP | 1.03 |
| TPSA | 43.60 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 1 |
| Heavy Atoms | 11 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 166.21 |
| LogP ≤ 5 | 1.03 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 5 |