C9H8N2OS — CID 175371107
4-methyl-1-(1,3-thiazol-2-yl)pyridin-2-one (PubChem CID 175371107) has the molecular formula C9H8N2OS and a molecular weight of 192.24 g/mol. Its IUPAC name is 4-methyl-1-(1,3-thiazol-2-yl)pyridin-2-one.
| Compound Name | 4-methyl-1-(1,3-thiazol-2-yl)pyridin-2-one |
|---|---|
| PubChem CID | 175371107 |
| Molecular Formula | C9H8N2OS |
| Molecular Weight | 192.24 g/mol |
| Exact Mass | 192.04 |
| IUPAC Name | 4-methyl-1-(1,3-thiazol-2-yl)pyridin-2-one |
| SMILES | Cc1ccn(-c2nccs2)c(=O)c1 |
| InChI | InChI=1S/C9H8N2OS/c1-7-2-4-11(8(12)6-7)9-10-3-5-13-9/h2-6H,1H3 |
| InChIKey | KEIOGPGKHUKSTM-UHFFFAOYSA-N |
| XLogP | 1.60 |
| TPSA | 34.89 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 1 |
| Heavy Atoms | 13 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 192.24 |
| LogP ≤ 5 | 1.60 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 4 |