C7H7N3OS — CID 130157569
5-methyl-2-(1,3-thiazol-2-yl)-4H-pyrazol-3-one (PubChem CID 130157569) has the molecular formula C7H7N3OS and a molecular weight of 181.22 g/mol. Its IUPAC name is 5-methyl-2-(1,3-thiazol-2-yl)-4H-pyrazol-3-one.
| Compound Name | 5-methyl-2-(1,3-thiazol-2-yl)-4H-pyrazol-3-one |
|---|---|
| PubChem CID | 130157569 |
| Molecular Formula | C7H7N3OS |
| Molecular Weight | 181.22 g/mol |
| Exact Mass | 181.03 |
| IUPAC Name | 5-methyl-2-(1,3-thiazol-2-yl)-4H-pyrazol-3-one |
| SMILES | CC1=NN(c2nccs2)C(=O)C1 |
| InChI | InChI=1S/C7H7N3OS/c1-5-4-6(11)10(9-5)7-8-2-3-12-7/h2-3H,4H2,1H3 |
| InChIKey | VBNMLIKFXYXAGR-UHFFFAOYSA-N |
| XLogP | 1.26 |
| TPSA | 45.56 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 1 |
| Heavy Atoms | 12 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 181.22 |
| LogP ≤ 5 | 1.26 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 4 |