C7H7N5OS — CID 82878352
3-amino-1-(1,3-thiazol-2-yl)pyrazole-4-carboxamide (PubChem CID 82878352) has the molecular formula C7H7N5OS and a molecular weight of 209.23 g/mol. Its IUPAC name is 3-amino-1-(1,3-thiazol-2-yl)pyrazole-4-carboxamide.
| Compound Name | 3-amino-1-(1,3-thiazol-2-yl)pyrazole-4-carboxamide |
|---|---|
| PubChem CID | 82878352 |
| Molecular Formula | C7H7N5OS |
| Molecular Weight | 209.23 g/mol |
| Exact Mass | 209.04 |
| IUPAC Name | 3-amino-1-(1,3-thiazol-2-yl)pyrazole-4-carboxamide |
| SMILES | NC(=O)c1cn(-c2nccs2)nc1N |
| InChI | InChI=1S/C7H7N5OS/c8-5-4(6(9)13)3-12(11-5)7-10-1-2-14-7/h1-3H,(H2,8,11)(H2,9,13) |
| InChIKey | IIPFSKZGKRJKFU-UHFFFAOYSA-N |
| XLogP | 0.01 |
| TPSA | 99.82 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 14 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 209.23 |
| LogP ≤ 5 | 0.01 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 6 |