C12H20Cl2O5 — CID 118024786
propan-2-yl 2,2-dichloro-4-[(4S)-2,2-dimethyl-1,3-dioxolan-4-yl]-3-hydroxybutanoate (PubChem CID 118024786) has the molecular formula C12H20Cl2O5 and a molecular weight of 315.19 g/mol. Its IUPAC name is propan-2-yl 2,2-dichloro-4-[(4S)-2,2-dimethyl-1,3-dioxolan-4-yl]-3-hydroxybutanoate.
| Compound Name | propan-2-yl 2,2-dichloro-4-[(4S)-2,2-dimethyl-1,3-dioxolan-4-yl]-3-hydroxybutanoate |
|---|---|
| PubChem CID | 118024786 |
| Molecular Formula | C12H20Cl2O5 |
| Molecular Weight | 315.19 g/mol |
| Exact Mass | 314.07 |
| IUPAC Name | propan-2-yl 2,2-dichloro-4-[(4S)-2,2-dimethyl-1,3-dioxolan-4-yl]-3-hydroxybutanoate |
| SMILES | CC(C)OC(=O)C(Cl)(Cl)C(O)C[C@H]1COC(C)(C)O1 |
| InChI | InChI=1S/C12H20Cl2O5/c1-7(2)18-10(16)12(13,14)9(15)5-8-6-17-11(3,4)19-8/h7-9,15H,5-6H2,1-4H3/t8-,9?/m0/s1 |
| InChIKey | ZSWXPEUYISNGIQ-IENPIDJESA-N |
| XLogP | 2.01 |
| TPSA | 64.99 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 19 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 315.19 |
| LogP ≤ 5 | 2.01 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'alkyl_halide', 'substructure': 'N/A'} |
|---|