C22H17ClF7N3O2 — CID 118025641
3-chloro-2-N-(2-cyanopropan-2-yl)-2-N-[4-(1,1,1,2,3,3,3-heptafluoropropan-2-yl)-2-methylphenyl]benzene-1,2-dicarboxamide (PubChem CID 118025641) has the molecular formula C22H17ClF7N3O2 and a molecular weight of 523.84 g/mol. Its IUPAC name is 3-chloro-2-N-(2-cyanopropan-2-yl)-2-N-[4-(1,1,1,2,3,3,3-heptafluoropropan-2-yl)-2-methylphenyl]benzene-1,2-dicarboxamide.
| Compound Name | 3-chloro-2-N-(2-cyanopropan-2-yl)-2-N-[4-(1,1,1,2,3,3,3-heptafluoropropan-2-yl)-2-methylphenyl]benzene-1,2-dicarboxamide |
|---|---|
| PubChem CID | 118025641 |
| Molecular Formula | C22H17ClF7N3O2 |
| Molecular Weight | 523.84 g/mol |
| Exact Mass | 523.09 |
| IUPAC Name | 3-chloro-2-N-(2-cyanopropan-2-yl)-2-N-[4-(1,1,1,2,3,3,3-heptafluoropropan-2-yl)-2-methylphenyl]benzene-1,2-dicarboxamide |
| SMILES | Cc1cc(C(F)(C(F)(F)F)C(F)(F)F)ccc1N(C(=O)c1c(Cl)cccc1C(N)=O)C(C)(C)C#N |
| InChI | InChI=1S/C22H17ClF7N3O2/c1-11-9-12(20(24,21(25,26)27)22(28,29)30)7-8-15(11)33(19(2,3)10-31)18(35)16-13(17(32)34)5-4-6-14(16)23/h4-9H,1-3H3,(H2,32,34) |
| InChIKey | ZAUKPYVJMMDXMP-UHFFFAOYSA-N |
| XLogP | 5.99 |
| TPSA | 87.19 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 35 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 523.84 |
| LogP ≤ 5 | 5.99 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |