C16H23NO5S — CID 118026029
tert-butyl 6-methyl-3-methylsulfonyloxy-3,4-dihydro-2H-quinoline-1-carboxylate (PubChem CID 118026029) has the molecular formula C16H23NO5S and a molecular weight of 341.43 g/mol. Its IUPAC name is tert-butyl 6-methyl-3-methylsulfonyloxy-3,4-dihydro-2H-quinoline-1-carboxylate.
| Compound Name | tert-butyl 6-methyl-3-methylsulfonyloxy-3,4-dihydro-2H-quinoline-1-carboxylate |
|---|---|
| PubChem CID | 118026029 |
| Molecular Formula | C16H23NO5S |
| Molecular Weight | 341.43 g/mol |
| Exact Mass | 341.13 |
| IUPAC Name | tert-butyl 6-methyl-3-methylsulfonyloxy-3,4-dihydro-2H-quinoline-1-carboxylate |
| SMILES | Cc1ccc2c(c1)CC(OS(C)(=O)=O)CN2C(=O)OC(C)(C)C |
| InChI | InChI=1S/C16H23NO5S/c1-11-6-7-14-12(8-11)9-13(22-23(5,19)20)10-17(14)15(18)21-16(2,3)4/h6-8,13H,9-10H2,1-5H3 |
| InChIKey | QBPZVFLQWUEPJU-UHFFFAOYSA-N |
| XLogP | 2.64 |
| TPSA | 72.91 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 23 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 341.43 |
| LogP ≤ 5 | 2.64 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'Sulfonic_acid_1', 'substructure': 'N/A'} |
|---|