C30H44O5 — CID 118027478
[4-(4-pentylcyclohexyl)cyclohexyl] 3-[4-(prop-2-enoyloxymethoxy)phenyl]propanoate (PubChem CID 118027478) has the molecular formula C30H44O5 and a molecular weight of 484.68 g/mol. Its IUPAC name is [4-(4-pentylcyclohexyl)cyclohexyl] 3-[4-(prop-2-enoyloxymethoxy)phenyl]propanoate.
| Compound Name | [4-(4-pentylcyclohexyl)cyclohexyl] 3-[4-(prop-2-enoyloxymethoxy)phenyl]propanoate |
|---|---|
| PubChem CID | 118027478 |
| Molecular Formula | C30H44O5 |
| Molecular Weight | 484.68 g/mol |
| Exact Mass | 484.32 |
| IUPAC Name | [4-(4-pentylcyclohexyl)cyclohexyl] 3-[4-(prop-2-enoyloxymethoxy)phenyl]propanoate |
| SMILES | C=CC(=O)OCOc1ccc(CCC(=O)OC2CCC(C3CCC(CCCCC)CC3)CC2)cc1 |
| InChI | InChI=1S/C30H44O5/c1-3-5-6-7-23-8-13-25(14-9-23)26-15-19-28(20-16-26)35-30(32)21-12-24-10-17-27(18-11-24)33-22-34-29(31)4-2/h4,10-11,17-18,23,25-26,28H,2-3,5-9,12-16,19-22H2,1H3 |
| InChIKey | UISCVFHMAAEYKW-UHFFFAOYSA-N |
| XLogP | 7.17 |
| TPSA | 61.83 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 13 |
| Heavy Atoms | 35 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 484.68 |
| LogP ≤ 5 | 7.17 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'het-C-het_not_in_ring', 'substructure': 'N/A'}, {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'} |
|---|