C28H35FN2O6S2 — CID 118035460
2-[[4-[[2-[(2-fluorophenyl)sulfonylamino]-2-methylpropanoyl]amino]-1-adamantyl]methyl]-4-methylbenzenesulfonic acid (PubChem CID 118035460) has the molecular formula C28H35FN2O6S2 and a molecular weight of 578.73 g/mol. Its IUPAC name is 2-[[4-[[2-[(2-fluorophenyl)sulfonylamino]-2-methylpropanoyl]amino]-1-adamantyl]methyl]-4-methylbenzenesulfonic acid.
| Compound Name | 2-[[4-[[2-[(2-fluorophenyl)sulfonylamino]-2-methylpropanoyl]amino]-1-adamantyl]methyl]-4-methylbenzenesulfonic acid |
|---|---|
| PubChem CID | 118035460 |
| Molecular Formula | C28H35FN2O6S2 |
| Molecular Weight | 578.73 g/mol |
| Exact Mass | 578.19 |
| IUPAC Name | 2-[[4-[[2-[(2-fluorophenyl)sulfonylamino]-2-methylpropanoyl]amino]-1-adamantyl]methyl]-4-methylbenzenesulfonic acid |
| SMILES | Cc1ccc(S(=O)(=O)O)c(CC23CC4CC(C2)C(NC(=O)C(C)(C)NS(=O)(=O)c2ccccc2F)C(C4)C3)c1 |
| InChI | InChI=1S/C28H35FN2O6S2/c1-17-8-9-23(39(35,36)37)19(10-17)14-28-13-18-11-20(15-28)25(21(12-18)16-28)30-26(32)27(2,3)31-38(33,34)24-7-5-4-6-22(24)29/h4-10,18,20-21,25,31H,11-16H2,1-3H3,(H,30,32)(H,35,36,37) |
| InChIKey | SRMVDUYOVPFDTH-UHFFFAOYSA-N |
| XLogP | 3.99 |
| TPSA | 129.64 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 39 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 578.73 |
| LogP ≤ 5 | 3.99 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'Sulfonic_acid_2', 'substructure': 'N/A'} |
|---|