C23H28BrF2N3O2 — CID 118036746
(1S,2R,3R,4R)-2-N-[(4-bromo-2-fluorophenyl)methyl]-3-N-(3-fluoropiperidin-4-yl)spiro[bicyclo[2.2.1]heptane-7,1'-cyclopropane]-2,3-dicarboxamide (PubChem CID 118036746) has the molecular formula C23H28BrF2N3O2 and a molecular weight of 496.40 g/mol. Its IUPAC name is (1S,2R,3R,4R)-2-N-[(4-bromo-2-fluorophenyl)methyl]-3-N-(3-fluoropiperidin-4-yl)spiro[bicyclo[2.2.1]heptane-7,1'-cyclopropane]-2,3-dicarboxamide.
| Compound Name | (1S,2R,3R,4R)-2-N-[(4-bromo-2-fluorophenyl)methyl]-3-N-(3-fluoropiperidin-4-yl)spiro[bicyclo[2.2.1]heptane-7,1'-cyclopropane]-2,3-dicarboxamide |
|---|---|
| PubChem CID | 118036746 |
| Molecular Formula | C23H28BrF2N3O2 |
| Molecular Weight | 496.40 g/mol |
| Exact Mass | 495.13 |
| IUPAC Name | (1S,2R,3R,4R)-2-N-[(4-bromo-2-fluorophenyl)methyl]-3-N-(3-fluoropiperidin-4-yl)spiro[bicyclo[2.2.1]heptane-7,1'-cyclopropane]-2,3-dicarboxamide |
| SMILES | O=C(NC1CCNCC1F)[C@H]1[C@H](C(=O)NCc2ccc(Br)cc2F)[C@@H]2CC[C@H]1C21CC1 |
| InChI | InChI=1S/C23H28BrF2N3O2/c24-13-2-1-12(16(25)9-13)10-28-21(30)19-14-3-4-15(23(14)6-7-23)20(19)22(31)29-18-5-8-27-11-17(18)26/h1-2,9,14-15,17-20,27H,3-8,10-11H2,(H,28,30)(H,29,31)/t14-,15+,17?,18?,19+,20+/m0/s1 |
| InChIKey | LYGVFSAECAMGSO-UHUHNGBPSA-N |
| XLogP | 3.07 |
| TPSA | 70.23 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 31 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 496.40 |
| LogP ≤ 5 | 3.07 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 3 |