C13H16BrFN2O2 — CID 97249638
1-[(4-bromo-2-fluorophenyl)methyl]-3-[(2R,3S)-2-methyloxolan-3-yl]urea (PubChem CID 97249638) has the molecular formula C13H16BrFN2O2 and a molecular weight of 331.19 g/mol. Its IUPAC name is 1-[(4-bromo-2-fluorophenyl)methyl]-3-[(2R,3S)-2-methyloxolan-3-yl]urea.
| Compound Name | 1-[(4-bromo-2-fluorophenyl)methyl]-3-[(2R,3S)-2-methyloxolan-3-yl]urea |
|---|---|
| PubChem CID | 97249638 |
| Molecular Formula | C13H16BrFN2O2 |
| Molecular Weight | 331.19 g/mol |
| Exact Mass | 330.04 |
| IUPAC Name | 1-[(4-bromo-2-fluorophenyl)methyl]-3-[(2R,3S)-2-methyloxolan-3-yl]urea |
| SMILES | C[C@H]1OCC[C@@H]1NC(=O)NCc1ccc(Br)cc1F |
| InChI | InChI=1S/C13H16BrFN2O2/c1-8-12(4-5-19-8)17-13(18)16-7-9-2-3-10(14)6-11(9)15/h2-3,6,8,12H,4-5,7H2,1H3,(H2,16,17,18)/t8-,12+/m1/s1 |
| InChIKey | QLRJMWYGERBORF-PELKAZGASA-N |
| XLogP | 2.56 |
| TPSA | 50.36 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 19 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 331.19 |
| LogP ≤ 5 | 2.56 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 2 |