C19H20N5O4+ — CID 118038776
1-(5-cyano-2-pyridinyl)-7-(dimethoxymethyl)-6-formyl-3,4-dihydro-2H-1,8-naphthyridin-1-ium-1-carboxamide (PubChem CID 118038776) has the molecular formula C19H20N5O4+ and a molecular weight of 382.40 g/mol. Its IUPAC name is 1-(5-cyano-2-pyridinyl)-7-(dimethoxymethyl)-6-formyl-3,4-dihydro-2H-1,8-naphthyridin-1-ium-1-carboxamide.
| Compound Name | 1-(5-cyano-2-pyridinyl)-7-(dimethoxymethyl)-6-formyl-3,4-dihydro-2H-1,8-naphthyridin-1-ium-1-carboxamide |
|---|---|
| PubChem CID | 118038776 |
| Molecular Formula | C19H20N5O4+ |
| Molecular Weight | 382.40 g/mol |
| Exact Mass | 382.15 |
| IUPAC Name | 1-(5-cyano-2-pyridinyl)-7-(dimethoxymethyl)-6-formyl-3,4-dihydro-2H-1,8-naphthyridin-1-ium-1-carboxamide |
| SMILES | COC(OC)c1nc2c(cc1C=O)CCC[N+]2(C(N)=O)c1ccc(C#N)cn1 |
| InChI | InChI=1S/C19H19N5O4/c1-27-18(28-2)16-14(11-25)8-13-4-3-7-24(19(21)26,17(13)23-16)15-6-5-12(9-20)10-22-15/h5-6,8,10-11,18H,3-4,7H2,1-2H3,(H-,21,26)/p+1 |
| InChIKey | GLPGAVGPUAAUNP-UHFFFAOYSA-O |
| XLogP | 2.12 |
| TPSA | 128.19 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 28 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 382.40 |
| LogP ≤ 5 | 2.12 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': 'aldehyde', 'substructure': 'N/A'}, {'alert_name': 'het-C-het_not_in_ring', 'substructure': 'N/A'}, {'alert_name': 'quaternary_nitrogen_2', 'substructure': 'N/A'} |
|---|