C18H16N4O2 — CID 118039362
4-(furo[2,3-d]pyrimidin-4-ylamino)-2-(3-methylbut-2-enoxy)benzonitrile (PubChem CID 118039362) has the molecular formula C18H16N4O2 and a molecular weight of 320.35 g/mol. Its IUPAC name is 4-(furo[2,3-d]pyrimidin-4-ylamino)-2-(3-methylbut-2-enoxy)benzonitrile.
| Compound Name | 4-(furo[2,3-d]pyrimidin-4-ylamino)-2-(3-methylbut-2-enoxy)benzonitrile |
|---|---|
| PubChem CID | 118039362 |
| Molecular Formula | C18H16N4O2 |
| Molecular Weight | 320.35 g/mol |
| Exact Mass | 320.13 |
| IUPAC Name | 4-(furo[2,3-d]pyrimidin-4-ylamino)-2-(3-methylbut-2-enoxy)benzonitrile |
| SMILES | CC(C)=CCOc1cc(Nc2ncnc3occc23)ccc1C#N |
| InChI | InChI=1S/C18H16N4O2/c1-12(2)5-7-23-16-9-14(4-3-13(16)10-19)22-17-15-6-8-24-18(15)21-11-20-17/h3-6,8-9,11H,7H2,1-2H3,(H,20,21,22) |
| InChIKey | YFUVHSLJKUIVFZ-UHFFFAOYSA-N |
| XLogP | 4.18 |
| TPSA | 83.97 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 24 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 320.35 |
| LogP ≤ 5 | 4.18 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|