C24H38O6 — CID 118042301
[2-[4-tert-butyl-2,6-bis(1-methoxyethyl)phenoxy]-2-oxoethyl] 2,2-dimethylbutanoate (PubChem CID 118042301) has the molecular formula C24H38O6 and a molecular weight of 422.56 g/mol. Its IUPAC name is [2-[4-tert-butyl-2,6-bis(1-methoxyethyl)phenoxy]-2-oxoethyl] 2,2-dimethylbutanoate.
| Compound Name | [2-[4-tert-butyl-2,6-bis(1-methoxyethyl)phenoxy]-2-oxoethyl] 2,2-dimethylbutanoate |
|---|---|
| PubChem CID | 118042301 |
| Molecular Formula | C24H38O6 |
| Molecular Weight | 422.56 g/mol |
| Exact Mass | 422.27 |
| IUPAC Name | [2-[4-tert-butyl-2,6-bis(1-methoxyethyl)phenoxy]-2-oxoethyl] 2,2-dimethylbutanoate |
| SMILES | CCC(C)(C)C(=O)OCC(=O)Oc1c(C(C)OC)cc(C(C)(C)C)cc1C(C)OC |
| InChI | InChI=1S/C24H38O6/c1-11-24(7,8)22(26)29-14-20(25)30-21-18(15(2)27-9)12-17(23(4,5)6)13-19(21)16(3)28-10/h12-13,15-16H,11,14H2,1-10H3 |
| InChIKey | VZERNKGQGMWPNJ-UHFFFAOYSA-N |
| XLogP | 5.28 |
| TPSA | 71.06 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 9 |
| Heavy Atoms | 30 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 422.56 |
| LogP ≤ 5 | 5.28 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'phenol_ester', 'substructure': 'N/A'} |
|---|