C20H22F3N5O3 — CID 118047281
tert-butyl 4-[6-oxo-11-(trifluoromethyl)-3,7,8,10-tetrazatricyclo[7.4.0.02,7]trideca-1(9),2,4,10,12-pentaen-4-yl]piperidine-1-carboxylate (PubChem CID 118047281) has the molecular formula C20H22F3N5O3 and a molecular weight of 437.42 g/mol. Its IUPAC name is tert-butyl 4-[6-oxo-11-(trifluoromethyl)-3,7,8,10-tetrazatricyclo[7.4.0.02,7]trideca-1(9),2,4,10,12-pentaen-4-yl]piperidine-1-carboxylate.
| Compound Name | tert-butyl 4-[6-oxo-11-(trifluoromethyl)-3,7,8,10-tetrazatricyclo[7.4.0.02,7]trideca-1(9),2,4,10,12-pentaen-4-yl]piperidine-1-carboxylate |
|---|---|
| PubChem CID | 118047281 |
| Molecular Formula | C20H22F3N5O3 |
| Molecular Weight | 437.42 g/mol |
| Exact Mass | 437.17 |
| IUPAC Name | tert-butyl 4-[6-oxo-11-(trifluoromethyl)-3,7,8,10-tetrazatricyclo[7.4.0.02,7]trideca-1(9),2,4,10,12-pentaen-4-yl]piperidine-1-carboxylate |
| SMILES | CC(C)(C)OC(=O)N1CCC(c2cc(=O)n3[nH]c4nc(C(F)(F)F)ccc4c3n2)CC1 |
| InChI | InChI=1S/C20H22F3N5O3/c1-19(2,3)31-18(30)27-8-6-11(7-9-27)13-10-15(29)28-17(24-13)12-4-5-14(20(21,22)23)25-16(12)26-28/h4-5,10-11H,6-9H2,1-3H3,(H,25,26) |
| InChIKey | AXQFXDGZPMEIEP-UHFFFAOYSA-N |
| XLogP | 3.70 |
| TPSA | 92.59 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 1 |
| Heavy Atoms | 31 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 437.42 |
| LogP ≤ 5 | 3.70 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 6 |