C9H12O7 — CID 118047935
dimethyl 4-methoxy-5-oxooxolane-2,3-dicarboxylate (PubChem CID 118047935) has the molecular formula C9H12O7 and a molecular weight of 232.19 g/mol. Its IUPAC name is dimethyl 4-methoxy-5-oxooxolane-2,3-dicarboxylate.
| Compound Name | dimethyl 4-methoxy-5-oxooxolane-2,3-dicarboxylate |
|---|---|
| PubChem CID | 118047935 |
| Molecular Formula | C9H12O7 |
| Molecular Weight | 232.19 g/mol |
| Exact Mass | 232.06 |
| IUPAC Name | dimethyl 4-methoxy-5-oxooxolane-2,3-dicarboxylate |
| SMILES | COC(=O)C1OC(=O)C(OC)C1C(=O)OC |
| InChI | InChI=1S/C9H12O7/c1-13-5-4(7(10)14-2)6(8(11)15-3)16-9(5)12/h4-6H,1-3H3 |
| InChIKey | ZCCCGVNRBAWQJD-UHFFFAOYSA-N |
| XLogP | -1.11 |
| TPSA | 88.13 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 16 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 232.19 |
| LogP ≤ 5 | -1.11 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': '>_2_ester_groups', 'substructure': 'N/A'} |
|---|