C13H13IO4 — CID 4976822
methyl 5-iodo-11-oxo-12-oxapentacyclo[6.4.0.02,6.03,10.04,7]dodecane-9-carboxylate (PubChem CID 4976822) has the molecular formula C13H13IO4 and a molecular weight of 360.15 g/mol. Its IUPAC name is methyl 5-iodo-11-oxo-12-oxapentacyclo[6.4.0.02,6.03,10.04,7]dodecane-9-carboxylate.
| Compound Name | methyl 5-iodo-11-oxo-12-oxapentacyclo[6.4.0.02,6.03,10.04,7]dodecane-9-carboxylate |
|---|---|
| PubChem CID | 4976822 |
| Molecular Formula | C13H13IO4 |
| Molecular Weight | 360.15 g/mol |
| Exact Mass | 359.99 |
| IUPAC Name | methyl 5-iodo-11-oxo-12-oxapentacyclo[6.4.0.02,6.03,10.04,7]dodecane-9-carboxylate |
| SMILES | COC(=O)C1C2C(=O)OC3C1C1C4C(I)C1C2C34 |
| InChI | InChI=1S/C13H13IO4/c1-17-12(15)9-7-2-4-3-6(5(2)10(4)14)11(7)18-13(16)8(3)9/h2-11H,1H3 |
| InChIKey | SPEKCFLSZSIFHL-UHFFFAOYSA-N |
| XLogP | 0.87 |
| TPSA | 52.60 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 1 |
| Heavy Atoms | 18 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 360.15 |
| LogP ≤ 5 | 0.87 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'alkyl_halide', 'substructure': 'N/A'}, {'alert_name': 'iodine', 'substructure': 'N/A'} |
|---|