C29H28N6O — CID 118048903
4-methyl-N-(1-piperazin-1-yl-2,3-dihydro-1H-inden-5-yl)-3-[2-(5H-pyrrolo[2,3-b]pyrazin-2-yl)ethynyl]benzamide (PubChem CID 118048903) has the molecular formula C29H28N6O and a molecular weight of 476.58 g/mol. Its IUPAC name is 4-methyl-N-(1-piperazin-1-yl-2,3-dihydro-1H-inden-5-yl)-3-[2-(5H-pyrrolo[2,3-b]pyrazin-2-yl)ethynyl]benzamide.
| Compound Name | 4-methyl-N-(1-piperazin-1-yl-2,3-dihydro-1H-inden-5-yl)-3-[2-(5H-pyrrolo[2,3-b]pyrazin-2-yl)ethynyl]benzamide |
|---|---|
| PubChem CID | 118048903 |
| Molecular Formula | C29H28N6O |
| Molecular Weight | 476.58 g/mol |
| Exact Mass | 476.23 |
| IUPAC Name | 4-methyl-N-(1-piperazin-1-yl-2,3-dihydro-1H-inden-5-yl)-3-[2-(5H-pyrrolo[2,3-b]pyrazin-2-yl)ethynyl]benzamide |
| SMILES | Cc1ccc(C(=O)Nc2ccc3c(c2)CCC3N2CCNCC2)cc1C#Cc1cnc2[nH]ccc2n1 |
| InChI | InChI=1S/C29H28N6O/c1-19-2-3-22(16-20(19)4-6-24-18-32-28-26(33-24)10-11-31-28)29(36)34-23-7-8-25-21(17-23)5-9-27(25)35-14-12-30-13-15-35/h2-3,7-8,10-11,16-18,27,30H,5,9,12-15H2,1H3,(H,31,32)(H,34,36) |
| InChIKey | ZBDIQMLUXHWZRA-UHFFFAOYSA-N |
| XLogP | 3.81 |
| TPSA | 85.94 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 36 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 476.58 |
| LogP ≤ 5 | 3.81 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'triple_bond', 'substructure': 'N/A'} |
|---|