C12H12 — CID 11805007
4-methylpenta-1,2,3-trienylbenzene (PubChem CID 11805007) has the molecular formula C12H12 and a molecular weight of 156.23 g/mol. Its IUPAC name is 4-methylpenta-1,2,3-trienylbenzene.
| Compound Name | 4-methylpenta-1,2,3-trienylbenzene |
|---|---|
| PubChem CID | 11805007 |
| Molecular Formula | C12H12 |
| Molecular Weight | 156.23 g/mol |
| Exact Mass | 156.09 |
| IUPAC Name | 4-methylpenta-1,2,3-trienylbenzene |
| SMILES | CC(C)=C=C=Cc1ccccc1 |
| InChI | InChI=1S/C12H12/c1-11(2)7-6-10-12-8-4-3-5-9-12/h3-5,8-10H,1-2H3 |
| InChIKey | JIAAGZXWZYLJPJ-UHFFFAOYSA-N |
| XLogP | 3.42 |
| TPSA | 0.00 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | |
| Rotatable Bonds | 1 |
| Heavy Atoms | 12 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 156.23 |
| LogP ≤ 5 | 3.42 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 0 |