C16H18 — CID 12825766
1,2-bis(3-methylbuta-1,2-dienyl)benzene (PubChem CID 12825766) has the molecular formula C16H18 and a molecular weight of 210.32 g/mol. Its IUPAC name is 1,2-bis(3-methylbuta-1,2-dienyl)benzene.
| Compound Name | 1,2-bis(3-methylbuta-1,2-dienyl)benzene |
|---|---|
| PubChem CID | 12825766 |
| Molecular Formula | C16H18 |
| Molecular Weight | 210.32 g/mol |
| Exact Mass | 210.14 |
| IUPAC Name | 1,2-bis(3-methylbuta-1,2-dienyl)benzene |
| SMILES | CC(C)=C=Cc1ccccc1C=C=C(C)C |
| InChI | InChI=1S/C16H18/c1-13(2)9-11-15-7-5-6-8-16(15)12-10-14(3)4/h5-8,11-12H,1-4H3 |
| InChIKey | LPIUSLSFARWCNG-UHFFFAOYSA-N |
| XLogP | 4.84 |
| TPSA | 0.00 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | |
| Rotatable Bonds | 2 |
| Heavy Atoms | 16 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 210.32 |
| LogP ≤ 5 | 4.84 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 0 |