About 1-(2-methylprop-2-enyl)-2-propa-1,2-dienylbenzene
1-(2-methylprop-2-enyl)-2-propa-1,2-dienylbenzene (PubChem CID 86068173) has the molecular formula C13H14
and a molecular weight of 170.25 g/mol. Its IUPAC name is 1-(2-methylprop-2-enyl)-2-propa-1,2-dienylbenzene.
Molecular Properties
| Compound Name | 1-(2-methylprop-2-enyl)-2-propa-1,2-dienylbenzene |
| PubChem CID | 86068173 |
| Molecular Formula | C13H14 |
| Molecular Weight | 170.25 g/mol |
| Exact Mass | 170.11 |
| IUPAC Name | 1-(2-methylprop-2-enyl)-2-propa-1,2-dienylbenzene |
| SMILES | C=C=Cc1ccccc1CC(=C)C |
| InChI | InChI=1S/C13H14/c1-4-7-12-8-5-6-9-13(12)10-11(2)3/h5-9H,1-2,10H2,3H3 |
| InChIKey | AEKHAAINHUTKCN-UHFFFAOYSA-N |
| XLogP | 3.60 |
| TPSA | 0.00 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | |
| Rotatable Bonds | 3 |
| Heavy Atoms | 13 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 170.25 |
| LogP ≤ 5 | 3.60 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 0 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|
Analyze 1-(2-methylprop-2-enyl)-2-propa-1,2-dienylbenzene with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 1-(2-methylprop-2-enyl)-2-propa-1,2-dienylbenzene?
The IUPAC name of 1-(2-methylprop-2-enyl)-2-propa-1,2-dienylbenzene (CID 86068173) is 1-(2-methylprop-2-enyl)-2-propa-1,2-dienylbenzene.
What is the SMILES notation for 1-(2-methylprop-2-enyl)-2-propa-1,2-dienylbenzene?
The canonical SMILES for 1-(2-methylprop-2-enyl)-2-propa-1,2-dienylbenzene is C=C=Cc1ccccc1CC(=C)C.
What is the InChIKey of 1-(2-methylprop-2-enyl)-2-propa-1,2-dienylbenzene?
The InChIKey is AEKHAAINHUTKCN-UHFFFAOYSA-N. The full InChI is InChI=1S/C13H14/c1-4-7-12-8-5-6-9-13(12)10-11(2)3/h5-9H,1-2,10H2,3H3.
What are the key properties of 1-(2-methylprop-2-enyl)-2-propa-1,2-dienylbenzene?
1-(2-methylprop-2-enyl)-2-propa-1,2-dienylbenzene has a molecular weight of 170.25 g/mol, XLogP of 3.60, 3 rotatable bonds, 0 hydrogen bond donors, and 0 hydrogen bond acceptors.
Where does this data come from?
All data for 1-(2-methylprop-2-enyl)-2-propa-1,2-dienylbenzene is sourced from PubChem (CID 86068173), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).