C72H64O2P2 — CID 139190653
benzene;bis(1-(3-diphenylphosphoryl-4,4-dimethylpenta-1,2-dienyl)-2-(2-phenylethynyl)benzene) (PubChem CID 139190653) has the molecular formula C72H64O2P2 and a molecular weight of 1023.25 g/mol. Its IUPAC name is benzene;bis(1-(3-diphenylphosphoryl-4,4-dimethylpenta-1,2-dienyl)-2-(2-phenylethynyl)benzene).
| Compound Name | benzene;bis(1-(3-diphenylphosphoryl-4,4-dimethylpenta-1,2-dienyl)-2-(2-phenylethynyl)benzene) |
|---|---|
| PubChem CID | 139190653 |
| Molecular Formula | C72H64O2P2 |
| Molecular Weight | 1023.25 g/mol |
| Exact Mass | 1022.44 |
| IUPAC Name | benzene;bis(1-(3-diphenylphosphoryl-4,4-dimethylpenta-1,2-dienyl)-2-(2-phenylethynyl)benzene) |
| SMILES | CC(C)(C)C(=C=Cc1ccccc1C#Cc1ccccc1)P(=O)(c1ccccc1)c1ccccc1.CC(C)(C)C(=C=Cc1ccccc1C#Cc1ccccc1)P(=O)(c1ccccc1)c1ccccc1.c1ccccc1 |
| InChI | InChI=1S/2C33H29OP.C6H6/c2*1-33(2,3)32(35(34,30-19-9-5-10-20-30)31-21-11-6-12-22-31)26-25-29-18-14-13-17-28(29)24-23-27-15-7-4-8-16-27;1-2-4-6-5-3-1/h2*4-22,25H,1-3H3;1-6H |
| InChIKey | JCBXZARIEZTAAO-UHFFFAOYSA-N |
| XLogP | 16.97 |
| TPSA | 34.14 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 76 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 1023.25 |
| LogP ≤ 5 | 16.97 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'phosphor', 'substructure': 'N/A'}, {'alert_name': 'triple_bond', 'substructure': 'N/A'} |
|---|