C15H20 — CID 132598194
2,6-dimethylhepta-4,5-dien-2-ylbenzene (PubChem CID 132598194) has the molecular formula C15H20 and a molecular weight of 200.32 g/mol. Its IUPAC name is 2,6-dimethylhepta-4,5-dien-2-ylbenzene.
| Compound Name | 2,6-dimethylhepta-4,5-dien-2-ylbenzene |
|---|---|
| PubChem CID | 132598194 |
| Molecular Formula | C15H20 |
| Molecular Weight | 200.32 g/mol |
| Exact Mass | 200.16 |
| IUPAC Name | 2,6-dimethylhepta-4,5-dien-2-ylbenzene |
| SMILES | CC(C)=C=CCC(C)(C)c1ccccc1 |
| InChI | InChI=1S/C15H20/c1-13(2)9-8-12-15(3,4)14-10-6-5-7-11-14/h5-8,10-11H,12H2,1-4H3 |
| InChIKey | OGSJWKFNUWHFLJ-UHFFFAOYSA-N |
| XLogP | 4.48 |
| TPSA | 0.00 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | |
| Rotatable Bonds | 3 |
| Heavy Atoms | 15 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 200.32 |
| LogP ≤ 5 | 4.48 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 0 |