C16H25NO2 — CID 159885537
N-tert-butyl-1-deuterioformamide;1-deuterio-3-methyl-3-phenylbutan-1-one (PubChem CID 159885537) has the molecular formula C16H25NO2 and a molecular weight of 265.39 g/mol. Its IUPAC name is N-tert-butyl-1-deuterioformamide;1-deuterio-3-methyl-3-phenylbutan-1-one.
| Compound Name | N-tert-butyl-1-deuterioformamide;1-deuterio-3-methyl-3-phenylbutan-1-one |
|---|---|
| PubChem CID | 159885537 |
| Molecular Formula | C16H25NO2 |
| Molecular Weight | 265.39 g/mol |
| Exact Mass | 265.20 |
| IUPAC Name | N-tert-butyl-1-deuterioformamide;1-deuterio-3-methyl-3-phenylbutan-1-one |
| SMILES | [2H]C(=O)CC(C)(C)c1ccccc1.[2H]C(=O)NC(C)(C)C |
| InChI | InChI=1S/C11H14O.C5H11NO/c1-11(2,8-9-12)10-6-4-3-5-7-10;1-5(2,3)6-4-7/h3-7,9H,8H2,1-2H3;4H,1-3H3,(H,6,7)/i9D;4D |
| InChIKey | NUBYGLGYRYNGBH-SGXBSXAJSA-N |
| XLogP | 3.08 |
| TPSA | 46.17 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 19 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 265.39 |
| LogP ≤ 5 | 3.08 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'aldehyde', 'substructure': 'N/A'} |
|---|