About N-tert-butyl-1-deuterioformamide;1-deuterio-3-methyl-3-phenylbutan-1-one
N-tert-butyl-1-deuterioformamide;1-deuterio-3-methyl-3-phenylbutan-1-one (PubChem CID 159885537) has the molecular formula C16H25NO2
and a molecular weight of 265.39 g/mol. Its IUPAC name is N-tert-butyl-1-deuterioformamide;1-deuterio-3-methyl-3-phenylbutan-1-one.
Molecular Properties
| Compound Name | N-tert-butyl-1-deuterioformamide;1-deuterio-3-methyl-3-phenylbutan-1-one |
| PubChem CID | 159885537 |
| Molecular Formula | C16H25NO2 |
| Molecular Weight | 265.39 g/mol |
| Exact Mass | 265.20 |
| IUPAC Name | N-tert-butyl-1-deuterioformamide;1-deuterio-3-methyl-3-phenylbutan-1-one |
| SMILES | [2H]C(=O)CC(C)(C)c1ccccc1.[2H]C(=O)NC(C)(C)C |
| InChI | InChI=1S/C11H14O.C5H11NO/c1-11(2,8-9-12)10-6-4-3-5-7-10;1-5(2,3)6-4-7/h3-7,9H,8H2,1-2H3;4H,1-3H3,(H,6,7)/i9D;4D |
| InChIKey | NUBYGLGYRYNGBH-SGXBSXAJSA-N |
| XLogP | 3.08 |
| TPSA | 46.17 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 19 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 265.39 |
| LogP ≤ 5 | 3.08 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 2 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'aldehyde', 'substructure': 'N/A'} |
|---|
Analyze N-tert-butyl-1-deuterioformamide;1-deuterio-3-methyl-3-phenylbutan-1-one with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of N-tert-butyl-1-deuterioformamide;1-deuterio-3-methyl-3-phenylbutan-1-one?
The IUPAC name of N-tert-butyl-1-deuterioformamide;1-deuterio-3-methyl-3-phenylbutan-1-one (CID 159885537) is N-tert-butyl-1-deuterioformamide;1-deuterio-3-methyl-3-phenylbutan-1-one.
What is the SMILES notation for N-tert-butyl-1-deuterioformamide;1-deuterio-3-methyl-3-phenylbutan-1-one?
The canonical SMILES for N-tert-butyl-1-deuterioformamide;1-deuterio-3-methyl-3-phenylbutan-1-one is [2H]C(=O)CC(C)(C)c1ccccc1.[2H]C(=O)NC(C)(C)C.
What is the InChIKey of N-tert-butyl-1-deuterioformamide;1-deuterio-3-methyl-3-phenylbutan-1-one?
The InChIKey is NUBYGLGYRYNGBH-SGXBSXAJSA-N. The full InChI is InChI=1S/C11H14O.C5H11NO/c1-11(2,8-9-12)10-6-4-3-5-7-10;1-5(2,3)6-4-7/h3-7,9H,8H2,1-2H3;4H,1-3H3,(H,6,7)/i9D;4D.
What are the key properties of N-tert-butyl-1-deuterioformamide;1-deuterio-3-methyl-3-phenylbutan-1-one?
N-tert-butyl-1-deuterioformamide;1-deuterio-3-methyl-3-phenylbutan-1-one has a molecular weight of 265.39 g/mol, XLogP of 3.08, 3 rotatable bonds, 1 hydrogen bond donors, and 2 hydrogen bond acceptors.
Where does this data come from?
All data for N-tert-butyl-1-deuterioformamide;1-deuterio-3-methyl-3-phenylbutan-1-one is sourced from PubChem (CID 159885537), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).